About 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide
3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide (PubChem CID 15535665) has the molecular formula C8H11O3P
and a molecular weight of 186.15 g/mol. Its IUPAC name is 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide.
Molecular Properties
| Compound Name | 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide |
| PubChem CID | 15535665 |
| Molecular Formula | C8H11O3P |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide |
| SMILES | C=CCOP1(=O)OCC=C1C=C |
| InChI | InChI=1S/C8H11O3P/c1-3-6-10-12(9)8(4-2)5-7-11-12/h3-5H,1-2,6-7H2 |
| InChIKey | BUFIXWASZATGLC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide?
The IUPAC name of 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide (CID 15535665) is 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide.
What is the SMILES notation for 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide?
The canonical SMILES for 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide is C=CCOP1(=O)OCC=C1C=C.
What is the InChIKey of 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide?
The InChIKey is BUFIXWASZATGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O3P/c1-3-6-10-12(9)8(4-2)5-7-11-12/h3-5H,1-2,6-7H2.
What are the key properties of 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide?
3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide has a molecular weight of 186.15 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-prop-2-enoxy-5H-1,2λ5-oxaphosphole 2-oxide is sourced from PubChem (CID 15535665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).