C19H30N2 — CID 155356808
(2Z,3Z,5E)-2-ethylidene-1-N,5-dimethyl-3-[(Z)-prop-1-enyl]-4-N-propylidenenona-3,5-diene-1,4-diimine (PubChem CID 155356808) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is (2Z,3Z,5E)-2-ethylidene-1-N,5-dimethyl-3-[(Z)-prop-1-enyl]-4-N-propylidenenona-3,5-diene-1,4-diimine.
| Compound Name | (2Z,3Z,5E)-2-ethylidene-1-N,5-dimethyl-3-[(Z)-prop-1-enyl]-4-N-propylidenenona-3,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 155356808 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (2Z,3Z,5E)-2-ethylidene-1-N,5-dimethyl-3-[(Z)-prop-1-enyl]-4-N-propylidenenona-3,5-diene-1,4-diimine |
| SMILES | C/C=C\C(C(=C\C)\C=N\C)=C(\N=C\CC)C(/C)=C/CCC |
| InChI | InChI=1S/C19H30N2/c1-7-11-13-16(5)19(21-14-9-3)18(12-8-2)17(10-4)15-20-6/h8,10,12-15H,7,9,11H2,1-6H3/b12-8-,16-13+,17-10+,19-18-,20-15+,21-14+ |
| InChIKey | PZLZHLXFLMZLOA-VEUUSWQSSA-N |
| XLogP | 5.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|