C18H27F3N2O — CID 155357019
1-[(Z,3E)-3-butylidene-1,1,1-trifluoro-6-methylidenenon-4-en-2-yl]-3-cyclopropylurea (PubChem CID 155357019) has the molecular formula C18H27F3N2O and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(Z,3E)-3-butylidene-1,1,1-trifluoro-6-methylidenenon-4-en-2-yl]-3-cyclopropylurea.
| Compound Name | 1-[(Z,3E)-3-butylidene-1,1,1-trifluoro-6-methylidenenon-4-en-2-yl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 155357019 |
| Molecular Formula | C18H27F3N2O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(Z,3E)-3-butylidene-1,1,1-trifluoro-6-methylidenenon-4-en-2-yl]-3-cyclopropylurea |
| SMILES | C=C(/C=C\C(=C/CCC)C(NC(=O)NC1CC1)C(F)(F)F)CCC |
| InChI | InChI=1S/C18H27F3N2O/c1-4-6-8-14(10-9-13(3)7-5-2)16(18(19,20)21)23-17(24)22-15-11-12-15/h8-10,15-16H,3-7,11-12H2,1-2H3,(H2,22,23,24)/b10-9-,14-8+ |
| InChIKey | CBVSQYPZZDSNJV-SIWKXLNPSA-N |
| XLogP | 5.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|