C16H15FN2O4 — CID 155357553
2-(2,6-dioxopiperidin-3-yl)-7-fluoro-5,5-dimethylcyclohepta[c]pyrrole-1,3-dione (PubChem CID 155357553) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-7-fluoro-5,5-dimethylcyclohepta[c]pyrrole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-7-fluoro-5,5-dimethylcyclohepta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 155357553 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-7-fluoro-5,5-dimethylcyclohepta[c]pyrrole-1,3-dione |
| SMILES | CC1(C)C=C(F)C=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=C1 |
| InChI | InChI=1S/C16H15FN2O4/c1-16(2)6-8(17)5-9-10(7-16)15(23)19(14(9)22)11-3-4-12(20)18-13(11)21/h5-7,11H,3-4H2,1-2H3,(H,18,20,21) |
| InChIKey | CWQIHIQNGZIHOP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|