C22H26N2O7 — CID 155358236
4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide (PubChem CID 155358236) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide.
| Compound Name | 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
|---|---|
| PubChem CID | 155358236 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
| SMILES | Cc1cc(OC2CCC3(CC2)OCCO3)ccc1C(=O)N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C22H26N2O7/c1-14-12-16(31-15-6-8-22(9-7-15)29-10-11-30-22)2-3-17(14)21(28)24(13-25)18-4-5-19(26)23-20(18)27/h2-3,12-13,15,18H,4-11H2,1H3,(H,23,26,27) |
| InChIKey | DYHFJHRVGYVVLY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|