C24H22FN6O3P — CID 155358471
5-fluoro-1-[[4-phosphanyl-3-(4-pyrimidin-2-ylpiperazine-1-carbonyl)phenyl]methyl]quinazoline-2,4-dione (PubChem CID 155358471) has the molecular formula C24H22FN6O3P and a molecular weight of 492.45 g/mol. Its IUPAC name is 5-fluoro-1-[[4-phosphanyl-3-(4-pyrimidin-2-ylpiperazine-1-carbonyl)phenyl]methyl]quinazoline-2,4-dione.
| Compound Name | 5-fluoro-1-[[4-phosphanyl-3-(4-pyrimidin-2-ylpiperazine-1-carbonyl)phenyl]methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 155358471 |
| Molecular Formula | C24H22FN6O3P |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 5-fluoro-1-[[4-phosphanyl-3-(4-pyrimidin-2-ylpiperazine-1-carbonyl)phenyl]methyl]quinazoline-2,4-dione |
| SMILES | O=C(c1cc(Cn2c(=O)[nH]c(=O)c3c(F)cccc32)ccc1P)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H22FN6O3P/c25-17-3-1-4-18-20(17)21(32)28-24(34)31(18)14-15-5-6-19(35)16(13-15)22(33)29-9-11-30(12-10-29)23-26-7-2-8-27-23/h1-8,13H,9-12,14,35H2,(H,28,32,34) |
| InChIKey | OLDSINRZNDRJTF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|