C19H35NO — CID 155358564
4-[(4E,6E)-5-ethyl-2,6-dimethylnona-4,6-dienyl]-1-methylpiperidin-4-ol (PubChem CID 155358564) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is 4-[(4E,6E)-5-ethyl-2,6-dimethylnona-4,6-dienyl]-1-methylpiperidin-4-ol.
| Compound Name | 4-[(4E,6E)-5-ethyl-2,6-dimethylnona-4,6-dienyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 155358564 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 4-[(4E,6E)-5-ethyl-2,6-dimethylnona-4,6-dienyl]-1-methylpiperidin-4-ol |
| SMILES | CC/C=C(C)/C(=C/CC(C)CC1(O)CCN(C)CC1)CC |
| InChI | InChI=1S/C19H35NO/c1-6-8-17(4)18(7-2)10-9-16(3)15-19(21)11-13-20(5)14-12-19/h8,10,16,21H,6-7,9,11-15H2,1-5H3/b17-8+,18-10+ |
| InChIKey | BGGFQXJZCVRTQT-SSPCNXNLSA-N |
| XLogP | 4.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|