C17H14F6S2 — CID 15535876
3-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene (PubChem CID 15535876) has the molecular formula C17H14F6S2 and a molecular weight of 396.42 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene.
| Compound Name | 3-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 15535876 |
| Molecular Formula | C17H14F6S2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 3-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene |
| SMILES | Cc1cc(C2=C(c3cc(C)sc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C17H14F6S2/c1-7-5-11(9(3)24-7)13-14(12-6-8(2)25-10(12)4)16(20,21)17(22,23)15(13,18)19/h5-6H,1-4H3 |
| InChIKey | TWYKYBTVPCIVEN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|