About 2-azidobutan-1-ol
2-azidobutan-1-ol (PubChem CID 15536141) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is 2-azidobutan-1-ol.
Molecular Properties
| Compound Name | 2-azidobutan-1-ol |
| PubChem CID | 15536141 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | 2-azidobutan-1-ol |
| SMILES | CCC(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C4H9N3O/c1-2-4(3-8)6-7-5/h4,8H,2-3H2,1H3 |
| InChIKey | JTHXGTVGYLMCJQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azidobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidobutan-1-ol?
The IUPAC name of 2-azidobutan-1-ol (CID 15536141) is 2-azidobutan-1-ol.
What is the SMILES notation for 2-azidobutan-1-ol?
The canonical SMILES for 2-azidobutan-1-ol is CCC(CO)N=[N+]=[N-].
What is the InChIKey of 2-azidobutan-1-ol?
The InChIKey is JTHXGTVGYLMCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O/c1-2-4(3-8)6-7-5/h4,8H,2-3H2,1H3.
What are the key properties of 2-azidobutan-1-ol?
2-azidobutan-1-ol has a molecular weight of 115.14 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidobutan-1-ol is sourced from PubChem (CID 15536141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).