C34H37N9O3 — CID 155362750
(12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 155362750) has the molecular formula C34H37N9O3 and a molecular weight of 619.73 g/mol. Its IUPAC name is (12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 155362750 |
| Molecular Formula | C34H37N9O3 |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CC(C)N1CCC(n2ccc3cc(Nc4ncc5c(=O)n6n(c5n4)-c4ccc5c(n4)N(CCC/C=C\C6)C(=O)CO5)ccc32)CC1 |
| InChI | InChI=1S/C34H37N9O3/c1-22(2)39-16-12-25(13-17-39)40-18-11-23-19-24(7-8-27(23)40)36-34-35-20-26-31(38-34)43-29-10-9-28-32(37-29)41(30(44)21-46-28)14-5-3-4-6-15-42(43)33(26)45/h4,6-11,18-20,22,25H,3,5,12-17,21H2,1-2H3,(H,35,36,38)/b6-4- |
| InChIKey | GZJNKASKJFNVEC-XQRVVYSFSA-N |
| XLogP | 4.80 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|