About 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline
8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline (PubChem CID 155362937) has the molecular formula C12H11BrN2O
and a molecular weight of 279.14 g/mol. Its IUPAC name is 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline.
Molecular Properties
| Compound Name | 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline |
| PubChem CID | 155362937 |
| Molecular Formula | C12H11BrN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline |
| SMILES | CC1Cc2cc3ccc(Br)cc3nc2NO1 |
| InChI | InChI=1S/C12H11BrN2O/c1-7-4-9-5-8-2-3-10(13)6-11(8)14-12(9)15-16-7/h2-3,5-7H,4H2,1H3,(H,14,15) |
| InChIKey | YHVULFOZRQEYRN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline?
The IUPAC name of 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline (CID 155362937) is 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline.
What is the SMILES notation for 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline?
The canonical SMILES for 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline is CC1Cc2cc3ccc(Br)cc3nc2NO1.
What is the InChIKey of 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline?
The InChIKey is YHVULFOZRQEYRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN2O/c1-7-4-9-5-8-2-3-10(13)6-11(8)14-12(9)15-16-7/h2-3,5-7H,4H2,1H3,(H,14,15).
What are the key properties of 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline?
8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline has a molecular weight of 279.14 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-methyl-3,4-dihydro-1H-oxazino[3,4-b]quinoline is sourced from PubChem (CID 155362937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).