C9H10F2N2O — CID 155363396
7,7-difluoro-4-methyl-2,5,6,8-tetrahydrophthalazin-1-one (PubChem CID 155363396) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 7,7-difluoro-4-methyl-2,5,6,8-tetrahydrophthalazin-1-one.
| Compound Name | 7,7-difluoro-4-methyl-2,5,6,8-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 155363396 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 7,7-difluoro-4-methyl-2,5,6,8-tetrahydrophthalazin-1-one |
| SMILES | Cc1n[nH]c(=O)c2c1CCC(F)(F)C2 |
| InChI | InChI=1S/C9H10F2N2O/c1-5-6-2-3-9(10,11)4-7(6)8(14)13-12-5/h2-4H2,1H3,(H,13,14) |
| InChIKey | CDEZMFGGTSBOKE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |