About 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine
8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine (PubChem CID 155363453) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine.
Molecular Properties
| Compound Name | 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine |
| PubChem CID | 155363453 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine |
| SMILES | [H]/N=c1\nc2cc(C)ccc2c2n1CCN2 |
| InChI | InChI=1S/C11H12N4/c1-7-2-3-8-9(6-7)14-11(12)15-5-4-13-10(8)15/h2-3,6,12-13H,4-5H2,1H3/b12-11+ |
| InChIKey | KNHOJSYTLMKNSY-VAWYXSNFSA-N |
| XLogP | 1.25 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine?
The IUPAC name of 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine (CID 155363453) is 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine.
What is the SMILES notation for 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine?
The canonical SMILES for 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine is [H]/N=c1\nc2cc(C)ccc2c2n1CCN2.
What is the InChIKey of 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine?
The InChIKey is KNHOJSYTLMKNSY-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H12N4/c1-7-2-3-8-9(6-7)14-11(12)15-5-4-13-10(8)15/h2-3,6,12-13H,4-5H2,1H3/b12-11+.
What are the key properties of 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine?
8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine has a molecular weight of 200.25 g/mol, XLogP of 1.25, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-imine is sourced from PubChem (CID 155363453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).