C13H12FNO — CID 155363799
7-fluoro-2,3,4,5-tetrahydrobenzo[i][1,4]benzoxazepine (PubChem CID 155363799) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 7-fluoro-2,3,4,5-tetrahydrobenzo[i][1,4]benzoxazepine.
| Compound Name | 7-fluoro-2,3,4,5-tetrahydrobenzo[i][1,4]benzoxazepine |
|---|---|
| PubChem CID | 155363799 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 7-fluoro-2,3,4,5-tetrahydrobenzo[i][1,4]benzoxazepine |
| SMILES | Fc1cc2c(c3ccccc13)OCCNC2 |
| InChI | InChI=1S/C13H12FNO/c14-12-7-9-8-15-5-6-16-13(9)11-4-2-1-3-10(11)12/h1-4,7,15H,5-6,8H2 |
| InChIKey | UNSPGKZISSAXCT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |