About 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine
2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 155363999) has the molecular formula C21H17N5S
and a molecular weight of 371.47 g/mol. Its IUPAC name is 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 155363999 |
| Molecular Formula | C21H17N5S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N)c2nc(-c3cccc(C#C[C@H](C)c4nccs4)c3)ccc2n1 |
| InChI | InChI=1S/C21H17N5S/c1-13(21-23-10-11-27-21)6-7-15-4-3-5-16(12-15)17-8-9-18-19(26-17)20(22)25-14(2)24-18/h3-5,8-13H,1-2H3,(H2,22,24,25)/t13-/m0/s1 |
| InChIKey | CEZXLRQNGZOULL-ZDUSSCGKSA-N |
| XLogP | 4.19 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine (CID 155363999) is 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine is Cc1nc(N)c2nc(-c3cccc(C#C[C@H](C)c4nccs4)c3)ccc2n1.
What is the InChIKey of 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is CEZXLRQNGZOULL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C21H17N5S/c1-13(21-23-10-11-27-21)6-7-15-4-3-5-16(12-15)17-8-9-18-19(26-17)20(22)25-14(2)24-18/h3-5,8-13H,1-2H3,(H2,22,24,25)/t13-/m0/s1.
What are the key properties of 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 371.47 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[3-[(3S)-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 155363999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).