C12H12N2O — CID 155364431
2,3,4,5-tetrahydropyrido[3,4-h][1,4]benzoxazepine (PubChem CID 155364431) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 2,3,4,5-tetrahydropyrido[3,4-h][1,4]benzoxazepine.
| Compound Name | 2,3,4,5-tetrahydropyrido[3,4-h][1,4]benzoxazepine |
|---|---|
| PubChem CID | 155364431 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2,3,4,5-tetrahydropyrido[3,4-h][1,4]benzoxazepine |
| SMILES | c1cc2cc3c(cc2cn1)CNCCO3 |
| InChI | InChI=1S/C12H12N2O/c1-2-13-7-10-5-11-8-14-3-4-15-12(11)6-9(1)10/h1-2,5-7,14H,3-4,8H2 |
| InChIKey | CANNTIWMPZBDIV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |