About 3-imino-N,11-dimethyldodec-10-en-2-amine
3-imino-N,11-dimethyldodec-10-en-2-amine (PubChem CID 155364759) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 3-imino-N,11-dimethyldodec-10-en-2-amine.
Molecular Properties
| Compound Name | 3-imino-N,11-dimethyldodec-10-en-2-amine |
| PubChem CID | 155364759 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 3-imino-N,11-dimethyldodec-10-en-2-amine |
| SMILES | [H]/N=C(\CCCCCCC=C(C)C)C(C)NC |
| InChI | InChI=1S/C14H28N2/c1-12(2)10-8-6-5-7-9-11-14(15)13(3)16-4/h10,13,15-16H,5-9,11H2,1-4H3/b15-14+ |
| InChIKey | ZQLOOCBJWGYTSE-CCEZHUSRSA-N |
| XLogP | 3.92 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-N,11-dimethyldodec-10-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-N,11-dimethyldodec-10-en-2-amine?
The IUPAC name of 3-imino-N,11-dimethyldodec-10-en-2-amine (CID 155364759) is 3-imino-N,11-dimethyldodec-10-en-2-amine.
What is the SMILES notation for 3-imino-N,11-dimethyldodec-10-en-2-amine?
The canonical SMILES for 3-imino-N,11-dimethyldodec-10-en-2-amine is [H]/N=C(\CCCCCCC=C(C)C)C(C)NC.
What is the InChIKey of 3-imino-N,11-dimethyldodec-10-en-2-amine?
The InChIKey is ZQLOOCBJWGYTSE-CCEZHUSRSA-N. The full InChI is InChI=1S/C14H28N2/c1-12(2)10-8-6-5-7-9-11-14(15)13(3)16-4/h10,13,15-16H,5-9,11H2,1-4H3/b15-14+.
What are the key properties of 3-imino-N,11-dimethyldodec-10-en-2-amine?
3-imino-N,11-dimethyldodec-10-en-2-amine has a molecular weight of 224.39 g/mol, XLogP of 3.92, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-N,11-dimethyldodec-10-en-2-amine is sourced from PubChem (CID 155364759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).