About (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine
(3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine (PubChem CID 155364830) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine |
| PubChem CID | 155364830 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine |
| SMILES | C=C(C)C(/C=C\C(=C)N1CCOCC1)CN |
| InChI | InChI=1S/C13H22N2O/c1-11(2)13(10-14)5-4-12(3)15-6-8-16-9-7-15/h4-5,13H,1,3,6-10,14H2,2H3/b5-4- |
| InChIKey | HZNXBFFXLYLOLH-PLNGDYQASA-N |
| XLogP | 1.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine?
The IUPAC name of (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine (CID 155364830) is (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine.
What is the SMILES notation for (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine?
The canonical SMILES for (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine is C=C(C)C(/C=C\C(=C)N1CCOCC1)CN.
What is the InChIKey of (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine?
The InChIKey is HZNXBFFXLYLOLH-PLNGDYQASA-N. The full InChI is InChI=1S/C13H22N2O/c1-11(2)13(10-14)5-4-12(3)15-6-8-16-9-7-15/h4-5,13H,1,3,6-10,14H2,2H3/b5-4-.
What are the key properties of (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine?
(3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine has a molecular weight of 222.33 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-morpholin-4-yl-2-prop-1-en-2-ylhexa-3,5-dien-1-amine is sourced from PubChem (CID 155364830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).