C20H27BrN2 — CID 155364844
(2E,4E)-4-bromo-N-ethenyl-N'-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienimidamide (PubChem CID 155364844) has the molecular formula C20H27BrN2 and a molecular weight of 375.35 g/mol. Its IUPAC name is (2E,4E)-4-bromo-N-ethenyl-N'-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienimidamide.
| Compound Name | (2E,4E)-4-bromo-N-ethenyl-N'-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 155364844 |
| Molecular Formula | C20H27BrN2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (2E,4E)-4-bromo-N-ethenyl-N'-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienimidamide |
| SMILES | C=CNC(=N\CC(/C=C\C(=C)C)=C/C)/C(=C/C(Br)=C\C)C(=C)C |
| InChI | InChI=1S/C20H27BrN2/c1-8-17(12-11-15(4)5)14-23-20(22-10-3)19(16(6)7)13-18(21)9-2/h8-13H,3-4,6,14H2,1-2,5,7H3,(H,22,23)/b12-11-,17-8+,18-9+,19-13+ |
| InChIKey | KEIPIGRMQRSYPB-SPLISZJDSA-N |
| XLogP | 6.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|