C13H17N3O4 — CID 155364917
4-(ethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione (PubChem CID 155364917) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-(ethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione.
| Compound Name | 4-(ethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
|---|---|
| PubChem CID | 155364917 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-(ethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
| SMILES | C=COCOc1c2n(ncc1=O)CCN(CCC)C2=O |
| InChI | InChI=1S/C13H17N3O4/c1-3-5-15-6-7-16-11(13(15)18)12(10(17)8-14-16)20-9-19-4-2/h4,8H,2-3,5-7,9H2,1H3 |
| InChIKey | PZUNEBRRZXEZDI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|