C15H21N3O6 — CID 155364918
(3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl propan-2-yl carbonate (PubChem CID 155364918) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl propan-2-yl carbonate.
| Compound Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 155364918 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl propan-2-yl carbonate |
| SMILES | CCCN1CCn2ncc(=O)c(OCOC(=O)OC(C)C)c2C1=O |
| InChI | InChI=1S/C15H21N3O6/c1-4-5-17-6-7-18-12(14(17)20)13(11(19)8-16-18)22-9-23-15(21)24-10(2)3/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | VTONGUPFCDCMOM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|