C15H21N3O4 — CID 155365030
4-(1-propan-2-yloxyethenoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione (PubChem CID 155365030) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(1-propan-2-yloxyethenoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione.
| Compound Name | 4-(1-propan-2-yloxyethenoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
|---|---|
| PubChem CID | 155365030 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 4-(1-propan-2-yloxyethenoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
| SMILES | C=C(Oc1c2n(ncc1=O)CCN(CCC)C2=O)OC(C)C |
| InChI | InChI=1S/C15H21N3O4/c1-5-6-17-7-8-18-13(15(17)20)14(12(19)9-16-18)22-11(4)21-10(2)3/h9-10H,4-8H2,1-3H3 |
| InChIKey | SEDLTIREJCKXSU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|