C46H30N4OS — CID 155365137
5-[7-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-[1]benzothiolo[3,2-c]carbazole (PubChem CID 155365137) has the molecular formula C46H30N4OS and a molecular weight of 686.84 g/mol. Its IUPAC name is 5-[7-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-[1]benzothiolo[3,2-c]carbazole.
| Compound Name | 5-[7-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-[1]benzothiolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 155365137 |
| Molecular Formula | C46H30N4OS |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | 5-[7-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-[1]benzothiolo[3,2-c]carbazole |
| SMILES | C=C/C(=C\C=C/C)c1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2c(-n4c5ccccc5c5c6sc7ccccc7c6ccc54)cccc23)n1 |
| InChI | InChI=1S/C46H30N4OS/c1-3-5-14-28(4-2)44-47-45(29-15-7-6-8-16-29)49-46(48-44)30-23-24-31-33-19-13-21-38(42(33)51-39(31)27-30)50-36-20-11-9-18-35(36)41-37(50)26-25-34-32-17-10-12-22-40(32)52-43(34)41/h3-27H,2H2,1H3/b5-3-,28-14+ |
| InChIKey | LMKZQKDXQZIFOX-XVXCPZKJSA-N |
| XLogP | 12.72 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|