C13H14N2O8 — CID 15536520
dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]pyrazole-3,4-dicarboxylate (PubChem CID 15536520) has the molecular formula C13H14N2O8 and a molecular weight of 326.26 g/mol. Its IUPAC name is dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]pyrazole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]pyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15536520 |
| Molecular Formula | C13H14N2O8 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]pyrazole-3,4-dicarboxylate |
| SMILES | COC(=O)/C=C(\C(=O)OC)n1cc(C(=O)OC)c(C(=O)OC)n1 |
| InChI | InChI=1S/C13H14N2O8/c1-20-9(16)5-8(12(18)22-3)15-6-7(11(17)21-2)10(14-15)13(19)23-4/h5-6H,1-4H3/b8-5+ |
| InChIKey | WYNXSSZSGYDRJJ-VMPITWQZSA-N |
| XLogP | -0.36 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|