About 3,7-dimethyltridecan-2-yl acetate
3,7-dimethyltridecan-2-yl acetate (PubChem CID 15536533) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 3,7-dimethyltridecan-2-yl acetate.
Molecular Properties
| Compound Name | 3,7-dimethyltridecan-2-yl acetate |
| PubChem CID | 15536533 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 3,7-dimethyltridecan-2-yl acetate |
| SMILES | CCCCCCC(C)CCCC(C)C(C)OC(C)=O |
| InChI | InChI=1S/C17H34O2/c1-6-7-8-9-11-14(2)12-10-13-15(3)16(4)19-17(5)18/h14-16H,6-13H2,1-5H3 |
| InChIKey | QWCOSIAVRMRFBR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyltridecan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyltridecan-2-yl acetate?
The IUPAC name of 3,7-dimethyltridecan-2-yl acetate (CID 15536533) is 3,7-dimethyltridecan-2-yl acetate.
What is the SMILES notation for 3,7-dimethyltridecan-2-yl acetate?
The canonical SMILES for 3,7-dimethyltridecan-2-yl acetate is CCCCCCC(C)CCCC(C)C(C)OC(C)=O.
What is the InChIKey of 3,7-dimethyltridecan-2-yl acetate?
The InChIKey is QWCOSIAVRMRFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-6-7-8-9-11-14(2)12-10-13-15(3)16(4)19-17(5)18/h14-16H,6-13H2,1-5H3.
What are the key properties of 3,7-dimethyltridecan-2-yl acetate?
3,7-dimethyltridecan-2-yl acetate has a molecular weight of 270.46 g/mol, XLogP of 5.35, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyltridecan-2-yl acetate is sourced from PubChem (CID 15536533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).