C29H26N2 — CID 155365452
2-(3,5-dimethylcyclohepta-1,3,5-trien-1-yl)-3-(3,5-dimethylphenyl)benzo[g]quinoxaline (PubChem CID 155365452) has the molecular formula C29H26N2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohepta-1,3,5-trien-1-yl)-3-(3,5-dimethylphenyl)benzo[g]quinoxaline.
| Compound Name | 2-(3,5-dimethylcyclohepta-1,3,5-trien-1-yl)-3-(3,5-dimethylphenyl)benzo[g]quinoxaline |
|---|---|
| PubChem CID | 155365452 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(3,5-dimethylcyclohepta-1,3,5-trien-1-yl)-3-(3,5-dimethylphenyl)benzo[g]quinoxaline |
| SMILES | CC1=CCC(c2nc3cc4ccccc4cc3nc2-c2cc(C)cc(C)c2)=CC(C)=C1 |
| InChI | InChI=1S/C29H26N2/c1-18-9-10-24(13-19(2)11-18)28-29(25-14-20(3)12-21(4)15-25)31-27-17-23-8-6-5-7-22(23)16-26(27)30-28/h5-9,11-17H,10H2,1-4H3 |
| InChIKey | OUKLZQXFTQRAQK-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|