C19H27N3O2 — CID 155365723
6-(4-tert-butylpiperazin-1-yl)-4,4-dimethylisoquinoline-1,3-dione (PubChem CID 155365723) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 6-(4-tert-butylpiperazin-1-yl)-4,4-dimethylisoquinoline-1,3-dione.
| Compound Name | 6-(4-tert-butylpiperazin-1-yl)-4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 155365723 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 6-(4-tert-butylpiperazin-1-yl)-4,4-dimethylisoquinoline-1,3-dione |
| SMILES | CC1(C)C(=O)NC(=O)c2ccc(N3CCN(C(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C19H27N3O2/c1-18(2,3)22-10-8-21(9-11-22)13-6-7-14-15(12-13)19(4,5)17(24)20-16(14)23/h6-7,12H,8-11H2,1-5H3,(H,20,23,24) |
| InChIKey | CLGXZYCAGWRATL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|