C25H20ClFN2O4 — CID 155365809
4-[1-(2-chloro-6-cyclopropylbenzoyl)-6-formyl-4,5,6,7-tetrahydroindazol-3-yl]-3-fluorobenzoic acid (PubChem CID 155365809) has the molecular formula C25H20ClFN2O4 and a molecular weight of 466.90 g/mol. Its IUPAC name is 4-[1-(2-chloro-6-cyclopropylbenzoyl)-6-formyl-4,5,6,7-tetrahydroindazol-3-yl]-3-fluorobenzoic acid.
| Compound Name | 4-[1-(2-chloro-6-cyclopropylbenzoyl)-6-formyl-4,5,6,7-tetrahydroindazol-3-yl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 155365809 |
| Molecular Formula | C25H20ClFN2O4 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4-[1-(2-chloro-6-cyclopropylbenzoyl)-6-formyl-4,5,6,7-tetrahydroindazol-3-yl]-3-fluorobenzoic acid |
| SMILES | O=CC1CCc2c(-c3ccc(C(=O)O)cc3F)nn(C(=O)c3c(Cl)cccc3C3CC3)c2C1 |
| InChI | InChI=1S/C25H20ClFN2O4/c26-19-3-1-2-16(14-5-6-14)22(19)24(31)29-21-10-13(12-30)4-8-18(21)23(28-29)17-9-7-15(25(32)33)11-20(17)27/h1-3,7,9,11-14H,4-6,8,10H2,(H,32,33) |
| InChIKey | YDWMQYHREDUYMJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|