C16H14O4S2 — CID 155366007
2,7-dimethyl-4b,9b-dihydro-[1]benzothiolo[3,2-b][1]benzothiole 5,5,10,10-tetraoxide (PubChem CID 155366007) has the molecular formula C16H14O4S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2,7-dimethyl-4b,9b-dihydro-[1]benzothiolo[3,2-b][1]benzothiole 5,5,10,10-tetraoxide.
| Compound Name | 2,7-dimethyl-4b,9b-dihydro-[1]benzothiolo[3,2-b][1]benzothiole 5,5,10,10-tetraoxide |
|---|---|
| PubChem CID | 155366007 |
| Molecular Formula | C16H14O4S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2,7-dimethyl-4b,9b-dihydro-[1]benzothiolo[3,2-b][1]benzothiole 5,5,10,10-tetraoxide |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)C1c3ccc(C)cc3S(=O)(=O)C21 |
| InChI | InChI=1S/C16H14O4S2/c1-9-3-5-11-13(7-9)21(17,18)16-12-6-4-10(2)8-14(12)22(19,20)15(11)16/h3-8,15-16H,1-2H3 |
| InChIKey | YFSMURNSBIXHTC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |