C45H22F4N4O2 — CID 155366204
4-[4-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]-3-phenylphenyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 155366204) has the molecular formula C45H22F4N4O2 and a molecular weight of 726.69 g/mol. Its IUPAC name is 4-[4-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]-3-phenylphenyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[4-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]-3-phenylphenyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 155366204 |
| Molecular Formula | C45H22F4N4O2 |
| Molecular Weight | 726.69 g/mol |
| Exact Mass | 726.17 |
| IUPAC Name | 4-[4-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]-3-phenylphenyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(-c2ccc(-n3c4ccc(-c5nc6ccccc6o5)cc4c4cc(-c5nc6ccccc6o5)ccc43)c(-c3ccccc3)c2)c(F)c1F |
| InChI | InChI=1S/C45H22F4N4O2/c46-40-31(23-50)41(47)43(49)39(42(40)48)25-14-17-34(28(20-25)24-8-2-1-3-9-24)53-35-18-15-26(44-51-32-10-4-6-12-37(32)54-44)21-29(35)30-22-27(16-19-36(30)53)45-52-33-11-5-7-13-38(33)55-45/h1-22H |
| InChIKey | UUTCUFAOXPYAGP-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.69 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|