C26H23F3N6O2 — CID 155366449
(11R)-12-[4-(difluoromethyl)-5-fluoro-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366449) has the molecular formula C26H23F3N6O2 and a molecular weight of 508.50 g/mol. Its IUPAC name is (11R)-12-[4-(difluoromethyl)-5-fluoro-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-[4-(difluoromethyl)-5-fluoro-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366449 |
| Molecular Formula | C26H23F3N6O2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (11R)-12-[4-(difluoromethyl)-5-fluoro-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1cc2c(C(F)F)c(F)ccc2[nH]1)C(=O)N(Cc1ccccn1)CC3 |
| InChI | InChI=1S/C26H23F3N6O2/c1-14-10-20-17(23-26(37)33(8-9-35(23)32-20)12-15-4-2-3-7-30-15)13-34(14)25(36)21-11-16-19(31-21)6-5-18(27)22(16)24(28)29/h2-7,11,14,24,31H,8-10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | LTDABJRQKSZNJH-CQSZACIVSA-N |
| XLogP | 4.08 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |