C26H22F4N6O2 — CID 155366450
(11R)-12-[5-fluoro-4-(trifluoromethyl)-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366450) has the molecular formula C26H22F4N6O2 and a molecular weight of 526.49 g/mol. Its IUPAC name is (11R)-12-[5-fluoro-4-(trifluoromethyl)-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-[5-fluoro-4-(trifluoromethyl)-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366450 |
| Molecular Formula | C26H22F4N6O2 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (11R)-12-[5-fluoro-4-(trifluoromethyl)-1H-indole-2-carbonyl]-11-methyl-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1cc2c(C(F)(F)F)c(F)ccc2[nH]1)C(=O)N(Cc1ccccn1)CC3 |
| InChI | InChI=1S/C26H22F4N6O2/c1-14-10-20-17(23-25(38)34(8-9-36(23)33-20)12-15-4-2-3-7-31-15)13-35(14)24(37)21-11-16-19(32-21)6-5-18(27)22(16)26(28,29)30/h2-7,11,14,32H,8-10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | MFCWPFHMMIFSIG-CQSZACIVSA-N |
| XLogP | 4.16 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |