C25H21F3N6O2 — CID 155366682
(11R)-11-methyl-4-(pyridin-2-ylmethyl)-12-(4,5,6-trifluoro-1H-indole-2-carbonyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366682) has the molecular formula C25H21F3N6O2 and a molecular weight of 494.48 g/mol. Its IUPAC name is (11R)-11-methyl-4-(pyridin-2-ylmethyl)-12-(4,5,6-trifluoro-1H-indole-2-carbonyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-11-methyl-4-(pyridin-2-ylmethyl)-12-(4,5,6-trifluoro-1H-indole-2-carbonyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366682 |
| Molecular Formula | C25H21F3N6O2 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (11R)-11-methyl-4-(pyridin-2-ylmethyl)-12-(4,5,6-trifluoro-1H-indole-2-carbonyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1cc2c(F)c(F)c(F)cc2[nH]1)C(=O)N(Cc1ccccn1)CC3 |
| InChI | InChI=1S/C25H21F3N6O2/c1-13-8-19-16(23-25(36)32(6-7-34(23)31-19)11-14-4-2-3-5-29-14)12-33(13)24(35)20-9-15-18(30-20)10-17(26)22(28)21(15)27/h2-5,9-10,13,30H,6-8,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | ZOLGICULSYXPKJ-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|