About (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone
(4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone (PubChem CID 155366980) has the molecular formula C19H12ClFN4O2
and a molecular weight of 382.78 g/mol. Its IUPAC name is (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone.
Molecular Properties
| Compound Name | (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone |
| PubChem CID | 155366980 |
| Molecular Formula | C19H12ClFN4O2 |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone |
| SMILES | Nc1ccnc2[nH]cc(C(=O)c3ncc(Oc4ccccc4F)cc3Cl)c12 |
| InChI | InChI=1S/C19H12ClFN4O2/c20-12-7-10(27-15-4-2-1-3-13(15)21)8-24-17(12)18(26)11-9-25-19-16(11)14(22)5-6-23-19/h1-9H,(H3,22,23,25) |
| InChIKey | OBLSRWRBBYFLGU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone?
The IUPAC name of (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone (CID 155366980) is (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone.
What is the SMILES notation for (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone?
The canonical SMILES for (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone is Nc1ccnc2[nH]cc(C(=O)c3ncc(Oc4ccccc4F)cc3Cl)c12.
What is the InChIKey of (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone?
The InChIKey is OBLSRWRBBYFLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClFN4O2/c20-12-7-10(27-15-4-2-1-3-13(15)21)8-24-17(12)18(26)11-9-25-19-16(11)14(22)5-6-23-19/h1-9H,(H3,22,23,25).
What are the key properties of (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone?
(4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone has a molecular weight of 382.78 g/mol, XLogP of 4.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)-[3-chloro-5-(2-fluorophenoxy)-2-pyridinyl]methanone is sourced from PubChem (CID 155366980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).