C19H22F3NO3 — CID 155367680
ethyl 4-(2,3-difluoro-4-hexoxyphenyl)-3-fluoro-1H-pyrrole-2-carboxylate (PubChem CID 155367680) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl 4-(2,3-difluoro-4-hexoxyphenyl)-3-fluoro-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-(2,3-difluoro-4-hexoxyphenyl)-3-fluoro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155367680 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl 4-(2,3-difluoro-4-hexoxyphenyl)-3-fluoro-1H-pyrrole-2-carboxylate |
| SMILES | CCCCCCOc1ccc(-c2c[nH]c(C(=O)OCC)c2F)c(F)c1F |
| InChI | InChI=1S/C19H22F3NO3/c1-3-5-6-7-10-26-14-9-8-12(15(20)17(14)22)13-11-23-18(16(13)21)19(24)25-4-2/h8-9,11,23H,3-7,10H2,1-2H3 |
| InChIKey | HENGIJZOPKEUET-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|