C11H17NO6 — CID 155368207
(Z)-but-2-enedioic acid;(Z)-2-propan-2-yloxybut-2-enamide (PubChem CID 155368207) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(Z)-2-propan-2-yloxybut-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(Z)-2-propan-2-yloxybut-2-enamide |
|---|---|
| PubChem CID | 155368207 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (Z)-but-2-enedioic acid;(Z)-2-propan-2-yloxybut-2-enamide |
| SMILES | C/C=C(\OC(C)C)C(N)=O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H13NO2.C4H4O4/c1-4-6(7(8)9)10-5(2)3;5-3(6)1-2-4(7)8/h4-5H,1-3H3,(H2,8,9);1-2H,(H,5,6)(H,7,8)/b6-4-;2-1- |
| InChIKey | DOWFGCDUYCIIQW-YQKCAVJMSA-N |
| XLogP | 0.51 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|