C19H22F3NO5 — CID 155368748
diethyl 2-[2-oxo-2-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]ethyl]propanedioate (PubChem CID 155368748) has the molecular formula C19H22F3NO5 and a molecular weight of 401.38 g/mol. Its IUPAC name is diethyl 2-[2-oxo-2-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]ethyl]propanedioate.
| Compound Name | diethyl 2-[2-oxo-2-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 155368748 |
| Molecular Formula | C19H22F3NO5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | diethyl 2-[2-oxo-2-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)C1C[C@H](c2c(F)ccc(F)c2F)CN1)C(=O)OCC |
| InChI | InChI=1S/C19H22F3NO5/c1-3-27-18(25)11(19(26)28-4-2)8-15(24)14-7-10(9-23-14)16-12(20)5-6-13(21)17(16)22/h5-6,10-11,14,23H,3-4,7-9H2,1-2H3/t10-,14?/m0/s1 |
| InChIKey | CXSJDWGVFFAKFM-XLLULAGJSA-N |
| XLogP | 2.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|