C22H21F4N7O — CID 155369144
2-(1-amino-2,2,2-trifluoroethyl)-8-(2,5-dimethylpyrazol-3-yl)-N-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methyl]imidazo[1,2-c]pyrimidin-5-amine (PubChem CID 155369144) has the molecular formula C22H21F4N7O and a molecular weight of 475.45 g/mol. Its IUPAC name is 2-(1-amino-2,2,2-trifluoroethyl)-8-(2,5-dimethylpyrazol-3-yl)-N-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methyl]imidazo[1,2-c]pyrimidin-5-amine.
| Compound Name | 2-(1-amino-2,2,2-trifluoroethyl)-8-(2,5-dimethylpyrazol-3-yl)-N-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methyl]imidazo[1,2-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 155369144 |
| Molecular Formula | C22H21F4N7O |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-(1-amino-2,2,2-trifluoroethyl)-8-(2,5-dimethylpyrazol-3-yl)-N-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methyl]imidazo[1,2-c]pyrimidin-5-amine |
| SMILES | Cc1cc(-c2cnc(NCc3c(F)ccc4c3CCO4)n3cc(C(N)C(F)(F)F)nc23)n(C)n1 |
| InChI | InChI=1S/C22H21F4N7O/c1-11-7-17(32(2)31-11)14-9-29-21(33-10-16(30-20(14)33)19(27)22(24,25)26)28-8-13-12-5-6-34-18(12)4-3-15(13)23/h3-4,7,9-10,19H,5-6,8,27H2,1-2H3,(H,28,29) |
| InChIKey | SHHKMZXKPTUBAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |