C30H18S6 — CID 15536945
2-(2,3,4,5,6-pentathiophen-2-ylphenyl)thiophene (PubChem CID 15536945) has the molecular formula C30H18S6 and a molecular weight of 570.88 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentathiophen-2-ylphenyl)thiophene.
| Compound Name | 2-(2,3,4,5,6-pentathiophen-2-ylphenyl)thiophene |
|---|---|
| PubChem CID | 15536945 |
| Molecular Formula | C30H18S6 |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 569.97 |
| IUPAC Name | 2-(2,3,4,5,6-pentathiophen-2-ylphenyl)thiophene |
| SMILES | c1csc(-c2c(-c3cccs3)c(-c3cccs3)c(-c3cccs3)c(-c3cccs3)c2-c2cccs2)c1 |
| InChI | InChI=1S/C30H18S6/c1-7-19(31-13-1)25-26(20-8-2-14-32-20)28(22-10-4-16-34-22)30(24-12-6-18-36-24)29(23-11-5-17-35-23)27(25)21-9-3-15-33-21/h1-18H |
| InChIKey | HRMOKPNCSIHUBF-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |