C28H36N2O6 — CID 155369482
3-[3-[2-[3-[2-carboxy-2-[(3R)-pyrrolidin-3-yl]ethyl]phenoxy]ethoxy]phenyl]-2-[(3R)-pyrrolidin-3-yl]propanoic acid (PubChem CID 155369482) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is 3-[3-[2-[3-[2-carboxy-2-[(3R)-pyrrolidin-3-yl]ethyl]phenoxy]ethoxy]phenyl]-2-[(3R)-pyrrolidin-3-yl]propanoic acid.
| Compound Name | 3-[3-[2-[3-[2-carboxy-2-[(3R)-pyrrolidin-3-yl]ethyl]phenoxy]ethoxy]phenyl]-2-[(3R)-pyrrolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 155369482 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-[3-[2-[3-[2-carboxy-2-[(3R)-pyrrolidin-3-yl]ethyl]phenoxy]ethoxy]phenyl]-2-[(3R)-pyrrolidin-3-yl]propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(OCCOc2cccc(CC(C(=O)O)[C@H]3CCNC3)c2)c1)[C@H]1CCNC1 |
| InChI | InChI=1S/C28H36N2O6/c31-27(32)25(21-7-9-29-17-21)15-19-3-1-5-23(13-19)35-11-12-36-24-6-2-4-20(14-24)16-26(28(33)34)22-8-10-30-18-22/h1-6,13-14,21-22,25-26,29-30H,7-12,15-18H2,(H,31,32)(H,33,34)/t21-,22-,25?,26?/m0/s1 |
| InChIKey | GVQKPOIKCFROBR-FPMFRTRJSA-N |
| XLogP | 2.85 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|