C72H168Cl12Si17 — CID 15536953
tetrakis[3-[tris[3-[chloro(dimethyl)silyl]propyl]silyl]propyl]silane (PubChem CID 15536953) has the molecular formula C72H168Cl12Si17 and a molecular weight of 1937.03 g/mol. Its IUPAC name is tetrakis[3-[tris[3-[chloro(dimethyl)silyl]propyl]silyl]propyl]silane.
| Compound Name | tetrakis[3-[tris[3-[chloro(dimethyl)silyl]propyl]silyl]propyl]silane |
|---|---|
| PubChem CID | 15536953 |
| Molecular Formula | C72H168Cl12Si17 |
| Molecular Weight | 1937.03 g/mol |
| Exact Mass | 1928.55 |
| IUPAC Name | tetrakis[3-[tris[3-[chloro(dimethyl)silyl]propyl]silyl]propyl]silane |
| SMILES | C[Si](C)(Cl)CCC[Si](CCC[Si](C)(C)Cl)(CCC[Si](C)(C)Cl)CCC[Si](CCC[Si](CCC[Si](C)(C)Cl)(CCC[Si](C)(C)Cl)CCC[Si](C)(C)Cl)(CCC[Si](CCC[Si](C)(C)Cl)(CCC[Si](C)(C)Cl)CCC[Si](C)(C)Cl)CCC[Si](CCC[Si](C)(C)Cl)(CCC[Si](C)(C)Cl)CCC[Si](C)(C)Cl |
| InChI | InChI=1S/C72H168Cl12Si17/c1-85(2,73)41-25-53-97(54-26-42-86(3,4)74,55-27-43-87(5,6)75)65-37-69-101(70-38-66-98(56-28-44-88(7,8)76,57-29-45-89(9,10)77)58-30-46-90(11,12)78,71-39-67-99(59-31-47-91(13,14)79,60-32-48-92(15,16)80)61-33-49-93(17,18)81)72-40-68-100(62-34-50-94(19,20)82,63-35-51-95(21,22)83)64-36-52-96(23,24)84/h25-72H2,1-24H3 |
| InChIKey | FVJNLLNGYLVNAA-UHFFFAOYSA-N |
| XLogP | 36.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 64 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1937.03 |
| LogP ≤ 5 | 36.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|