C20H25ClF3N3O5S — CID 155369989
N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2,2,2-trifluoroethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155369989) has the molecular formula C20H25ClF3N3O5S and a molecular weight of 511.95 g/mol. Its IUPAC name is N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2,2,2-trifluoroethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2,2,2-trifluoroethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155369989 |
| Molecular Formula | C20H25ClF3N3O5S |
| Molecular Weight | 511.95 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2,2,2-trifluoroethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | O=C1CN(CCCCCS(=O)(=O)N[C@@H](c2ccc(Cl)c(OCC3CC3)c2)C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C20H25ClF3N3O5S/c21-15-7-6-14(10-16(15)32-12-13-4-5-13)18(20(22,23)24)26-33(30,31)9-3-1-2-8-27-11-17(28)25-19(27)29/h6-7,10,13,18,26H,1-5,8-9,11-12H2,(H,25,28,29)/t18-/m0/s1 |
| InChIKey | OOFSJAXCXZYTFT-SFHVURJKSA-N |
| XLogP | 3.37 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|