C22H30ClN3O5S — CID 155370023
N-[(1S)-6-chloro-5-(cyclopropylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155370023) has the molecular formula C22H30ClN3O5S and a molecular weight of 484.02 g/mol. Its IUPAC name is N-[(1S)-6-chloro-5-(cyclopropylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1S)-6-chloro-5-(cyclopropylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155370023 |
| Molecular Formula | C22H30ClN3O5S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[(1S)-6-chloro-5-(cyclopropylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | O=C1CN(CCCCCS(=O)(=O)N[C@H]2CCCc3c2ccc(Cl)c3OCC2CC2)C(=O)N1 |
| InChI | InChI=1S/C22H30ClN3O5S/c23-18-10-9-16-17(21(18)31-14-15-7-8-15)5-4-6-19(16)25-32(29,30)12-3-1-2-11-26-13-20(27)24-22(26)28/h9-10,15,19,25H,1-8,11-14H2,(H,24,27,28)/t19-/m0/s1 |
| InChIKey | JTUOWAPMJIFVHE-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|