C21H27ClF3N3O5S — CID 155370109
N-[(1R)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-3,3,3-trifluoropropyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155370109) has the molecular formula C21H27ClF3N3O5S and a molecular weight of 525.98 g/mol. Its IUPAC name is N-[(1R)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-3,3,3-trifluoropropyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-3,3,3-trifluoropropyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155370109 |
| Molecular Formula | C21H27ClF3N3O5S |
| Molecular Weight | 525.98 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | N-[(1R)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-3,3,3-trifluoropropyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | O=C1CN(CCCCCS(=O)(=O)N[C@H](CC(F)(F)F)c2ccc(Cl)c(OCC3CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C21H27ClF3N3O5S/c22-16-7-6-15(10-18(16)33-13-14-4-5-14)17(11-21(23,24)25)27-34(31,32)9-3-1-2-8-28-12-19(29)26-20(28)30/h6-7,10,14,17,27H,1-5,8-9,11-13H2,(H,26,29,30)/t17-/m1/s1 |
| InChIKey | TZUYCNXTXSQSSO-QGZVFWFLSA-N |
| XLogP | 3.76 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.98 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|