C20H28F3N3O5S — CID 155370212
N-[5-[[1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]cyclopropyl]sulfamoyl]pentyl-ethylcarbamoyl]formamide (PubChem CID 155370212) has the molecular formula C20H28F3N3O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is N-[5-[[1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]cyclopropyl]sulfamoyl]pentyl-ethylcarbamoyl]formamide.
| Compound Name | N-[5-[[1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]cyclopropyl]sulfamoyl]pentyl-ethylcarbamoyl]formamide |
|---|---|
| PubChem CID | 155370212 |
| Molecular Formula | C20H28F3N3O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[5-[[1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]cyclopropyl]sulfamoyl]pentyl-ethylcarbamoyl]formamide |
| SMILES | CCN(CCCCCS(=O)(=O)NC1(c2ccc(F)c(OCC(F)F)c2)CC1)C(=O)NC=O |
| InChI | InChI=1S/C20H28F3N3O5S/c1-2-26(19(28)24-14-27)10-4-3-5-11-32(29,30)25-20(8-9-20)15-6-7-16(21)17(12-15)31-13-18(22)23/h6-7,12,14,18,25H,2-5,8-11,13H2,1H3,(H,24,27,28) |
| InChIKey | QJSHGZPZMPTLFU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|