C21H27NO — CID 155370372
3-ethenyl-4-(2-methoxyethyl)-5,7-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]-3,4-dihydroisoquinoline (PubChem CID 155370372) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-ethenyl-4-(2-methoxyethyl)-5,7-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]-3,4-dihydroisoquinoline.
| Compound Name | 3-ethenyl-4-(2-methoxyethyl)-5,7-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 155370372 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-ethenyl-4-(2-methoxyethyl)-5,7-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]-3,4-dihydroisoquinoline |
| SMILES | C=CC1N=C(C(=C)/C=C\C)c2cc(C)cc(C)c2C1CCOC |
| InChI | InChI=1S/C21H27NO/c1-7-9-15(4)21-18-13-14(3)12-16(5)20(18)17(10-11-23-6)19(8-2)22-21/h7-9,12-13,17,19H,2,4,10-11H2,1,3,5-6H3/b9-7- |
| InChIKey | UPJQQSNOLVIVFR-CLFYSBASSA-N |
| XLogP | 4.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|