C26H37NO — CID 155370388
3-ethenyl-4-(2-methoxyethyl)-4,7-dimethyl-1-[(3E)-4,5,5-trimethylhepta-1,3-dien-2-yl]-3H-isoquinoline (PubChem CID 155370388) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is 3-ethenyl-4-(2-methoxyethyl)-4,7-dimethyl-1-[(3E)-4,5,5-trimethylhepta-1,3-dien-2-yl]-3H-isoquinoline.
| Compound Name | 3-ethenyl-4-(2-methoxyethyl)-4,7-dimethyl-1-[(3E)-4,5,5-trimethylhepta-1,3-dien-2-yl]-3H-isoquinoline |
|---|---|
| PubChem CID | 155370388 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | 3-ethenyl-4-(2-methoxyethyl)-4,7-dimethyl-1-[(3E)-4,5,5-trimethylhepta-1,3-dien-2-yl]-3H-isoquinoline |
| SMILES | C=CC1N=C(C(=C)/C=C(\C)C(C)(C)CC)c2cc(C)ccc2C1(C)CCOC |
| InChI | InChI=1S/C26H37NO/c1-10-23-26(8,14-15-28-9)22-13-12-18(3)16-21(22)24(27-23)19(4)17-20(5)25(6,7)11-2/h10,12-13,16-17,23H,1,4,11,14-15H2,2-3,5-9H3/b20-17+ |
| InChIKey | ZKSLLRLJTMHUFC-LVZFUZTISA-N |
| XLogP | 6.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|