C20H21N9O2 — CID 155370751
4-[(3S,4E)-3-amino-4-methoxyiminopyrrolidin-1-yl]-N-methyl-2-pyrimidin-5-yloxy-9H-pyrimido[4,5-b]indol-8-amine (PubChem CID 155370751) has the molecular formula C20H21N9O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 4-[(3S,4E)-3-amino-4-methoxyiminopyrrolidin-1-yl]-N-methyl-2-pyrimidin-5-yloxy-9H-pyrimido[4,5-b]indol-8-amine.
| Compound Name | 4-[(3S,4E)-3-amino-4-methoxyiminopyrrolidin-1-yl]-N-methyl-2-pyrimidin-5-yloxy-9H-pyrimido[4,5-b]indol-8-amine |
|---|---|
| PubChem CID | 155370751 |
| Molecular Formula | C20H21N9O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[(3S,4E)-3-amino-4-methoxyiminopyrrolidin-1-yl]-N-methyl-2-pyrimidin-5-yloxy-9H-pyrimido[4,5-b]indol-8-amine |
| SMILES | CNc1cccc2c1[nH]c1nc(Oc3cncnc3)nc(N3C/C(=N\OC)[C@@H](N)C3)c12 |
| InChI | InChI=1S/C20H21N9O2/c1-22-14-5-3-4-12-16-18(25-17(12)14)26-20(31-11-6-23-10-24-7-11)27-19(16)29-8-13(21)15(9-29)28-30-2/h3-7,10,13,22H,8-9,21H2,1-2H3,(H,25,26,27)/b28-15+/t13-/m0/s1 |
| InChIKey | MSBLTYJVGQXMCH-CRVZXYNNSA-N |
| XLogP | 1.88 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|