About 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide
2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide (PubChem CID 155370833) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide.
Molecular Properties
| Compound Name | 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide |
| PubChem CID | 155370833 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide |
| SMILES | C=N/C(CN)=N/C=C(\C)C(C)C |
| InChI | InChI=1S/C9H17N3/c1-7(2)8(3)6-12-9(5-10)11-4/h6-7H,4-5,10H2,1-3H3/b8-6+,12-9+ |
| InChIKey | QQZJGQRAOSYAOW-CPQOCIIQSA-N |
| XLogP | 1.60 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide?
The IUPAC name of 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide (CID 155370833) is 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide.
What is the SMILES notation for 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide?
The canonical SMILES for 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide is C=N/C(CN)=N/C=C(\C)C(C)C.
What is the InChIKey of 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide?
The InChIKey is QQZJGQRAOSYAOW-CPQOCIIQSA-N. The full InChI is InChI=1S/C9H17N3/c1-7(2)8(3)6-12-9(5-10)11-4/h6-7H,4-5,10H2,1-3H3/b8-6+,12-9+.
What are the key properties of 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide?
2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide has a molecular weight of 167.26 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylideneethanimidamide is sourced from PubChem (CID 155370833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).