C25H28FN7O3 — CID 155371034
4-[(1S,4S,5S)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-[[6-(methoxymethoxymethyl)-3-pyridinyl]oxy]-N-methyl-9H-pyrimido[4,5-b]indol-8-amine (PubChem CID 155371034) has the molecular formula C25H28FN7O3 and a molecular weight of 493.54 g/mol. Its IUPAC name is 4-[(1S,4S,5S)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-[[6-(methoxymethoxymethyl)-3-pyridinyl]oxy]-N-methyl-9H-pyrimido[4,5-b]indol-8-amine.
| Compound Name | 4-[(1S,4S,5S)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-[[6-(methoxymethoxymethyl)-3-pyridinyl]oxy]-N-methyl-9H-pyrimido[4,5-b]indol-8-amine |
|---|---|
| PubChem CID | 155371034 |
| Molecular Formula | C25H28FN7O3 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 4-[(1S,4S,5S)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-[[6-(methoxymethoxymethyl)-3-pyridinyl]oxy]-N-methyl-9H-pyrimido[4,5-b]indol-8-amine |
| SMILES | CNc1cc(F)cc2c1[nH]c1nc(Oc3ccc(COCOC)nc3)nc(N3C[C@@H]4C[C@H]3C[C@@H]4N)c12 |
| InChI | InChI=1S/C25H28FN7O3/c1-28-20-7-14(26)6-18-21-23(30-22(18)20)31-25(32-24(21)33-10-13-5-16(33)8-19(13)27)36-17-4-3-15(29-9-17)11-35-12-34-2/h3-4,6-7,9,13,16,19,28H,5,8,10-12,27H2,1-2H3,(H,30,31,32)/t13-,16-,19-/m0/s1 |
| InChIKey | QRHHAUAHFNBBSW-AXHNFQJDSA-N |
| XLogP | 3.53 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|